Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Indium(III) trifluoromethanesulfonate, 99% min
CAS: 128008-30-0 Molecular Formula: C3F9InO9S3 Molecular Weight (g/mol): 562.008 MDL Number: MFCD00144478 InChI Key: UCYRAEIHXSVXPV-UHFFFAOYSA-K Synonym: indium iii trifluoromethanesulfonate,indium triflate,indium trifluoromethanesulphonate,indium 3+ tritriflate,indium 3+ ; trifluoromethanesulfonate,indium iii triflate,indium iii trifluoromethanesulphonate,acmc-209bda,in tfa 3,ksc491q8t PubChem CID: 2734680 IUPAC Name: indium(3+);trifluoromethanesulfonate SMILES: C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].[In+3]
| PubChem CID | 2734680 |
|---|---|
| CAS | 128008-30-0 |
| Molecular Weight (g/mol) | 562.008 |
| MDL Number | MFCD00144478 |
| SMILES | C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].[In+3] |
| Synonym | indium iii trifluoromethanesulfonate,indium triflate,indium trifluoromethanesulphonate,indium 3+ tritriflate,indium 3+ ; trifluoromethanesulfonate,indium iii triflate,indium iii trifluoromethanesulphonate,acmc-209bda,in tfa 3,ksc491q8t |
| IUPAC Name | indium(3+);trifluoromethanesulfonate |
| InChI Key | UCYRAEIHXSVXPV-UHFFFAOYSA-K |
| Molecular Formula | C3F9InO9S3 |
Zirconium slug, 6.35mm (0.25in) dia x 12.7mm (0.50in) length, 99.95% (metals basis excluding Hf), Hf nominal 3%, Thermo Scientific Chemicals
CAS: 7440-67-7 Molecular Formula: Zr Molecular Weight (g/mol): 91.22 MDL Number: MFCD00011303 MFCD00148878 InChI Key: QCWXUUIWCKQGHC-UHFFFAOYSA-N Synonym: zircat,powder,circonio,zirconium, elemental,zirconio,zirkonium,compounds,unii-c6v6s92n3c,and compounds,foil PubChem CID: 23995 ChEBI: CHEBI:33342 IUPAC Name: zirconium SMILES: [Zr]
| PubChem CID | 23995 |
|---|---|
| CAS | 7440-67-7 |
| Molecular Weight (g/mol) | 91.22 |
| ChEBI | CHEBI:33342 |
| MDL Number | MFCD00011303 MFCD00148878 |
| SMILES | [Zr] |
| Synonym | zircat,powder,circonio,zirconium, elemental,zirconio,zirkonium,compounds,unii-c6v6s92n3c,and compounds,foil |
| IUPAC Name | zirconium |
| InChI Key | QCWXUUIWCKQGHC-UHFFFAOYSA-N |
| Molecular Formula | Zr |
Magnesium Sulfate, Anhydrous, Powder, BAKER ANALYZED Reagent, For USP/NF analysis, J.T. Baker™
CAS: 7487-88-9 Molecular Formula: MgO4S Molecular Weight (g/mol): 120.36 MDL Number: MFCD00011110 InChI Key: CSNNHWWHGAXBCP-UHFFFAOYSA-L Synonym: magnesium sulfate,magnesium sulphate,magnesium sulfate anhydrous,sulfuric acid magnesium salt 1:1,bitter salt,sal angalis,magnesium sulfate 1:1,mgso4,sal de sedlitz,tomix ot PubChem CID: 24083 ChEBI: CHEBI:32599 IUPAC Name: magnesium(2+) sulfate SMILES: [Mg++].[O-]S([O-])(=O)=O
| PubChem CID | 24083 |
|---|---|
| CAS | 7487-88-9 |
| Molecular Weight (g/mol) | 120.36 |
| ChEBI | CHEBI:32599 |
| MDL Number | MFCD00011110 |
| SMILES | [Mg++].[O-]S([O-])(=O)=O |
| Synonym | magnesium sulfate,magnesium sulphate,magnesium sulfate anhydrous,sulfuric acid magnesium salt 1:1,bitter salt,sal angalis,magnesium sulfate 1:1,mgso4,sal de sedlitz,tomix ot |
| IUPAC Name | magnesium(2+) sulfate |
| InChI Key | CSNNHWWHGAXBCP-UHFFFAOYSA-L |
| Molecular Formula | MgO4S |
Triethylsilanol, 97%
CAS: 597-52-4 Molecular Formula: C6H16OSi Molecular Weight (g/mol): 132.278 MDL Number: MFCD00042640 InChI Key: WVMSIBFANXCZKT-UHFFFAOYSA-N Synonym: triethylsilanol,silanol, triethyl,hydroxytriethylsilane,silanol, 1,1,1-triethyl,triethyl hydroxy silane,triethyl hydroxy silicon,tesoh,c2h5 3sioh,acmc-1an47 PubChem CID: 69005 IUPAC Name: triethyl(hydroxy)silane SMILES: CC[Si](CC)(CC)O
| PubChem CID | 69005 |
|---|---|
| CAS | 597-52-4 |
| Molecular Weight (g/mol) | 132.278 |
| MDL Number | MFCD00042640 |
| SMILES | CC[Si](CC)(CC)O |
| Synonym | triethylsilanol,silanol, triethyl,hydroxytriethylsilane,silanol, 1,1,1-triethyl,triethyl hydroxy silane,triethyl hydroxy silicon,tesoh,c2h5 3sioh,acmc-1an47 |
| IUPAC Name | triethyl(hydroxy)silane |
| InChI Key | WVMSIBFANXCZKT-UHFFFAOYSA-N |
| Molecular Formula | C6H16OSi |
Manganese, 99+%, powder, -40 mesh
CAS: 7439-96-5 Molecular Formula: Mn Molecular Weight (g/mol): 54.94 MDL Number: MFCD00011111 InChI Key: PWHULOQIROXLJO-UHFFFAOYSA-N Synonym: colloidal,mangan,manganese, elemental,cutaval,magnacat,metal alloy,tronamang,fume,mangan polish,compounds PubChem CID: 23930 ChEBI: CHEBI:35154 IUPAC Name: manganese SMILES: [Mn]
| PubChem CID | 23930 |
|---|---|
| CAS | 7439-96-5 |
| Molecular Weight (g/mol) | 54.94 |
| ChEBI | CHEBI:35154 |
| MDL Number | MFCD00011111 |
| SMILES | [Mn] |
| Synonym | colloidal,mangan,manganese, elemental,cutaval,magnacat,metal alloy,tronamang,fume,mangan polish,compounds |
| IUPAC Name | manganese |
| InChI Key | PWHULOQIROXLJO-UHFFFAOYSA-N |
| Molecular Formula | Mn |
Lithium Chloride Molecular Biology Reagent MP Biomedicals
CAS: 7447-41-8 Molecular Formula: ClLi Molecular Weight (g/mol): 42.39 MDL Number: MFCD00011078 InChI Key: KWGKDLIKAYFUFQ-UHFFFAOYSA-M Synonym: lithium chloride,lithium chloride licl,lithiumchloride,licl,chlorure de lithium,chlorku litu,chlorolithium,lithiumchlorid,chlorku litu polish,luthium chloride PubChem CID: 433294 ChEBI: CHEBI:48607 IUPAC Name: lithium(1+) chloride SMILES: [Li+].[Cl-]
| PubChem CID | 433294 |
|---|---|
| CAS | 7447-41-8 |
| Molecular Weight (g/mol) | 42.39 |
| ChEBI | CHEBI:48607 |
| MDL Number | MFCD00011078 |
| SMILES | [Li+].[Cl-] |
| Synonym | lithium chloride,lithium chloride licl,lithiumchloride,licl,chlorure de lithium,chlorku litu,chlorolithium,lithiumchlorid,chlorku litu polish,luthium chloride |
| IUPAC Name | lithium(1+) chloride |
| InChI Key | KWGKDLIKAYFUFQ-UHFFFAOYSA-M |
| Molecular Formula | ClLi |
Aluminum oxide, Drysphere∣r desiccant, without indicator
CAS: 1344-28-1 Molecular Formula: Al2O3 Molecular Weight (g/mol): 101.96 MDL Number: MFCD00003424 InChI Key: PNEYBMLMFCGWSK-UHFFFAOYSA-N Synonym: aluminum oxide,aluminum oxide,alpha-alumina,fasertonerde,abramant,abramax,abrarex,abrasit,aloxite,alundum PubChem CID: 9989226 SMILES: [O--].[O--].[O--].[Al+3].[Al+3]
| PubChem CID | 9989226 |
|---|---|
| CAS | 1344-28-1 |
| Molecular Weight (g/mol) | 101.96 |
| MDL Number | MFCD00003424 |
| SMILES | [O--].[O--].[O--].[Al+3].[Al+3] |
| Synonym | aluminum oxide,aluminum oxide,alpha-alumina,fasertonerde,abramant,abramax,abrarex,abrasit,aloxite,alundum |
| InChI Key | PNEYBMLMFCGWSK-UHFFFAOYSA-N |
| Molecular Formula | Al2O3 |
Cadmium sulfide, 99.999% (metals basis)
CAS: 1306-23-6 Molecular Formula: CdS Molecular Weight (g/mol): 144.47 MDL Number: MFCD00010922 InChI Key: FRLJSGOEGLARCA-UHFFFAOYSA-N Synonym: cadmium sulfide,cadmium sulphide,capsebon,orange cadmium,cadmopur yellow,jaune brilliant,aurora yellow,cadmium orange,cadmium yellow,ferro yellow PubChem CID: 14783 ChEBI: CHEBI:50833 IUPAC Name: sulfanylidenecadmium SMILES: [S--].[Cd++]
| PubChem CID | 14783 |
|---|---|
| CAS | 1306-23-6 |
| Molecular Weight (g/mol) | 144.47 |
| ChEBI | CHEBI:50833 |
| MDL Number | MFCD00010922 |
| SMILES | [S--].[Cd++] |
| Synonym | cadmium sulfide,cadmium sulphide,capsebon,orange cadmium,cadmopur yellow,jaune brilliant,aurora yellow,cadmium orange,cadmium yellow,ferro yellow |
| IUPAC Name | sulfanylidenecadmium |
| InChI Key | FRLJSGOEGLARCA-UHFFFAOYSA-N |
| Molecular Formula | CdS |
Silicon(IV) oxide, amorphous fumed, surface treated, S.A. 105-145m2/g
CAS: 7631-86-9 Molecular Formula: O2Si Molecular Weight (g/mol): 60.08 MDL Number: MFCD00011232 MFCD00217788 MFCD00163736 MFCD00148266 MFCD00603035 MFCD02100519 MFCD06202255 MFCD07370733 InChI Key: VYPSYNLAJGMNEJ-UHFFFAOYSA-N Synonym: silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous PubChem CID: 24261 ChEBI: CHEBI:30563 SMILES: O=[Si]=O
| PubChem CID | 24261 |
|---|---|
| CAS | 7631-86-9 |
| Molecular Weight (g/mol) | 60.08 |
| ChEBI | CHEBI:30563 |
| MDL Number | MFCD00011232 MFCD00217788 MFCD00163736 MFCD00148266 MFCD00603035 MFCD02100519 MFCD06202255 MFCD07370733 |
| SMILES | O=[Si]=O |
| Synonym | silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous |
| InChI Key | VYPSYNLAJGMNEJ-UHFFFAOYSA-N |
| Molecular Formula | O2Si |
Silicon(IV) oxide, amorphous fumed, surface treated, S.A. 205-245m2/g
CAS: 7631-86-9 Molecular Formula: O2Si Molecular Weight (g/mol): 60.08 MDL Number: MFCD00011232 MFCD00217788 MFCD00163736 MFCD00148266 MFCD00603035 MFCD02100519 MFCD06202255 MFCD07370733 InChI Key: VYPSYNLAJGMNEJ-UHFFFAOYSA-N Synonym: silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous PubChem CID: 24261 ChEBI: CHEBI:30563 IUPAC Name: dioxosilane SMILES: O=[Si]=O
| PubChem CID | 24261 |
|---|---|
| CAS | 7631-86-9 |
| Molecular Weight (g/mol) | 60.08 |
| ChEBI | CHEBI:30563 |
| MDL Number | MFCD00011232 MFCD00217788 MFCD00163736 MFCD00148266 MFCD00603035 MFCD02100519 MFCD06202255 MFCD07370733 |
| SMILES | O=[Si]=O |
| Synonym | silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous |
| IUPAC Name | dioxosilane |
| InChI Key | VYPSYNLAJGMNEJ-UHFFFAOYSA-N |
| Molecular Formula | O2Si |
Platinum, 5% on activated carbon paste, B103032-5
CAS: 6-4-7440 Molecular Formula: Pt Molecular Weight (g/mol): 195.08 MDL Number: MFCD00011179 InChI Key: BASFCYQUMIYNBI-UHFFFAOYSA-N Synonym: black,platin,sponge,platinum, metal,platinum, elemental,platine,platino,metal,platin german,iv ion PubChem CID: 23939 ChEBI: CHEBI:33400 IUPAC Name: platinum SMILES: [Pt]
| PubChem CID | 23939 |
|---|---|
| CAS | 6-4-7440 |
| Molecular Weight (g/mol) | 195.08 |
| ChEBI | CHEBI:33400 |
| MDL Number | MFCD00011179 |
| SMILES | [Pt] |
| Synonym | black,platin,sponge,platinum, metal,platinum, elemental,platine,platino,metal,platin german,iv ion |
| IUPAC Name | platinum |
| InChI Key | BASFCYQUMIYNBI-UHFFFAOYSA-N |
| Molecular Formula | Pt |
Nickel(II) lactate tetrahydrate, 98%
Molecular Formula: C6H10NiO6·4H2O MDL Number: MFCD02683106
| MDL Number | MFCD02683106 |
|---|---|
| Molecular Formula | C6H10NiO6·4H2O |
Diethoxymethylphenylsilane, 97+%
CAS: 775-56-4 Molecular Formula: C11H18O2Si Molecular Weight (g/mol): 210.35 MDL Number: MFCD00048541 InChI Key: MNFGEHQPOWJJBH-UHFFFAOYSA-N Synonym: methylphenyldiethoxysilane,diethoxy methyl phenylsilane,diethoxy methyl phenyl silane,silane, diethoxymethylphenyl,benzene, diethoxymethylsilyl,pubchem10811,acmc-209pap,methyl-phenyl-diethoxysilane,diethoxy-methyl-phenyl-silane PubChem CID: 69891 IUPAC Name: diethoxy-methyl-phenylsilane SMILES: CCO[Si](C)(OCC)C1=CC=CC=C1
| PubChem CID | 69891 |
|---|---|
| CAS | 775-56-4 |
| Molecular Weight (g/mol) | 210.35 |
| MDL Number | MFCD00048541 |
| SMILES | CCO[Si](C)(OCC)C1=CC=CC=C1 |
| Synonym | methylphenyldiethoxysilane,diethoxy methyl phenylsilane,diethoxy methyl phenyl silane,silane, diethoxymethylphenyl,benzene, diethoxymethylsilyl,pubchem10811,acmc-209pap,methyl-phenyl-diethoxysilane,diethoxy-methyl-phenyl-silane |
| IUPAC Name | diethoxy-methyl-phenylsilane |
| InChI Key | MNFGEHQPOWJJBH-UHFFFAOYSA-N |
| Molecular Formula | C11H18O2Si |
Zinc selenide, 99.999% (metals basis)
CAS: 1315-09-9 Molecular Formula: SeZn Molecular Weight (g/mol): 144.35 MDL Number: MFCD00011296 InChI Key: GTLQJUQHDTWYJC-UHFFFAOYSA-N Synonym: zinc selenide znse,znse,zinc selenide, spectro,zinc selenide, powder, 10 mum trace metals basis,zinc selenide crystal optic disc, 13mm x 1mm, polished both sides,zinc selenide crystal optic disc, 13mm x 2mm, polished both sides,zinc selenide crystal optic disc, 25mm x 2mm, polished both sides,zinc selenide optical window, 12.7mm 0.5in dia x 1mm 0.04in thick,zinc selenide optical window, 12.7mm 0.5in dia x 2mm 0.08in thick,zinc selenide optical window, 25.4mm 1.0in dia x 1mm 0.04in thick IUPAC Name: zinc(2+) selandiide SMILES: [Zn++].[Se--]
| CAS | 1315-09-9 |
|---|---|
| Molecular Weight (g/mol) | 144.35 |
| MDL Number | MFCD00011296 |
| SMILES | [Zn++].[Se--] |
| Synonym | zinc selenide znse,znse,zinc selenide, spectro,zinc selenide, powder, 10 mum trace metals basis,zinc selenide crystal optic disc, 13mm x 1mm, polished both sides,zinc selenide crystal optic disc, 13mm x 2mm, polished both sides,zinc selenide crystal optic disc, 25mm x 2mm, polished both sides,zinc selenide optical window, 12.7mm 0.5in dia x 1mm 0.04in thick,zinc selenide optical window, 12.7mm 0.5in dia x 2mm 0.08in thick,zinc selenide optical window, 25.4mm 1.0in dia x 1mm 0.04in thick |
| IUPAC Name | zinc(2+) selandiide |
| InChI Key | GTLQJUQHDTWYJC-UHFFFAOYSA-N |
| Molecular Formula | SeZn |
Sodium metaborate tetrahydrate, tech.
CAS: 10555-76-7 Molecular Formula: BH8NaO6 Molecular Weight (g/mol): 137.86 MDL Number: MFCD00149205 InChI Key: JAKYJVJWXKRTSJ-UHFFFAOYSA-N Synonym: sodium metaborate tetrahydrate,sodium tetrahydrate oxoborinate,na.bo2.4h2o,boric acid, sodium salt, tetrahydrate PubChem CID: 23694267 IUPAC Name: sodium;oxido(oxo)borane;tetrahydrate SMILES: O.O.O.O.[Na+].[O-]B=O
| PubChem CID | 23694267 |
|---|---|
| CAS | 10555-76-7 |
| Molecular Weight (g/mol) | 137.86 |
| MDL Number | MFCD00149205 |
| SMILES | O.O.O.O.[Na+].[O-]B=O |
| Synonym | sodium metaborate tetrahydrate,sodium tetrahydrate oxoborinate,na.bo2.4h2o,boric acid, sodium salt, tetrahydrate |
| IUPAC Name | sodium;oxido(oxo)borane;tetrahydrate |
| InChI Key | JAKYJVJWXKRTSJ-UHFFFAOYSA-N |
| Molecular Formula | BH8NaO6 |